6B0
(2,3-dichlorophenyl)methanol
| Created: | 2016-02-26 |
| Last modified: | 2017-03-08 |
Find Related PDB Entry |
|---|
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 16 |
| Chiral Atom Count | 0 |
| Bond Count | 16 |
| Aromatic Bond Count | 6 |
Chemical Component Summary | |
|---|---|
| Name | (2,3-dichlorophenyl)methanol |
| Systematic Name (OpenEye OEToolkits) | [2,3-bis(chloranyl)phenyl]methanol |
| Formula | C7 H6 Cl2 O |
| Molecular Weight | 177.028 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | ACDLabs | 12.01 | OCc1cccc(Cl)c1Cl |
| SMILES | CACTVS | 3.385 | OCc1cccc(Cl)c1Cl |
| SMILES | OpenEye OEToolkits | 2.0.4 | c1cc(c(c(c1)Cl)Cl)CO |
| Canonical SMILES | CACTVS | 3.385 | OCc1cccc(Cl)c1Cl |
| Canonical SMILES | OpenEye OEToolkits | 2.0.4 | c1cc(c(c(c1)Cl)Cl)CO |
| InChI | InChI | 1.03 | InChI=1S/C7H6Cl2O/c8-6-3-1-2-5(4-10)7(6)9/h1-3,10H,4H2 |
| InChIKey | InChI | 1.03 | STVBVTWXWZMRPZ-UHFFFAOYSA-N |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 228603 |
| CCDC/CSD | DOPNAA |














