A1IO7
(2~{R},3~{R},4~{R},5~{S})-2-(hydroxymethyl)-2-pentyl-piperidine-3,4,5-triol
| Created: | 2024-09-20 |
| Last modified: | 2025-10-01 |
Find Related PDB Entry |
|---|
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 39 |
| Chiral Atom Count | 4 |
| Bond Count | 39 |
| Aromatic Bond Count | 0 |
Chemical Component Summary | |
|---|---|
| Name | (2~{R},3~{R},4~{R},5~{S})-2-(hydroxymethyl)-2-pentyl-piperidine-3,4,5-triol |
| Systematic Name (OpenEye OEToolkits) | (2~{R},3~{R},4~{R},5~{S})-2-(hydroxymethyl)-2-pentyl-piperidine-3,4,5-triol |
| Formula | C11 H23 N O4 |
| Molecular Weight | 233.305 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | CACTVS | 3.385 | CCCCC[C]1(CO)NC[CH](O)[CH](O)[CH]1O |
| SMILES | OpenEye OEToolkits | 2.0.7 | CCCCCC1(C(C(C(CN1)O)O)O)CO |
| Canonical SMILES | CACTVS | 3.385 | CCCCC[C@]1(CO)NC[C@H](O)[C@@H](O)[C@@H]1O |
| Canonical SMILES | OpenEye OEToolkits | 2.0.7 | CCCCC[C@]1([C@H]([C@@H]([C@H](CN1)O)O)O)CO |
| InChI | InChI | 1.06 | InChI=1S/C11H23NO4/c1-2-3-4-5-11(7-13)10(16)9(15)8(14)6-12-11/h8-10,12-16H,2-7H2,1H3/t8-,9+,10-,11+/m0/s1 |
| InChIKey | InChI | 1.06 | ATZIJQARFQJARY-ZRUFSTJUSA-N |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 164628630 |
| ChEMBL | CHEMBL5029066 |














