A6M
(3R)-3-amino-4-(4-chlorophenyl)-1-[(3R,4S)-3-(4-chlorophenyl)-4-(hydroxymethyl)pyrrolidin-1-yl]butan-1-one
| Created: | 2014-04-14 |
| Last modified: | 2014-10-01 |
Find Related PDB Entry |
|---|
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 51 |
| Chiral Atom Count | 3 |
| Bond Count | 53 |
| Aromatic Bond Count | 12 |
Chemical Component Summary | |
|---|---|
| Name | (3R)-3-amino-4-(4-chlorophenyl)-1-[(3R,4S)-3-(4-chlorophenyl)-4-(hydroxymethyl)pyrrolidin-1-yl]butan-1-one |
| Systematic Name (OpenEye OEToolkits) | (3R)-3-azanyl-4-(4-chlorophenyl)-1-[(3R,4S)-3-(4-chlorophenyl)-4-(hydroxymethyl)pyrrolidin-1-yl]butan-1-one |
| Formula | C21 H24 Cl2 N2 O2 |
| Molecular Weight | 407.333 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | ACDLabs | 12.01 | O=C(N2CC(c1ccc(Cl)cc1)C(CO)C2)CC(N)Cc3ccc(Cl)cc3 |
| SMILES | CACTVS | 3.385 | N[CH](CC(=O)N1C[CH](CO)[CH](C1)c2ccc(Cl)cc2)Cc3ccc(Cl)cc3 |
| SMILES | OpenEye OEToolkits | 1.7.6 | c1cc(ccc1CC(CC(=O)N2CC(C(C2)c3ccc(cc3)Cl)CO)N)Cl |
| Canonical SMILES | CACTVS | 3.385 | N[C@@H](CC(=O)N1C[C@@H](CO)[C@@H](C1)c2ccc(Cl)cc2)Cc3ccc(Cl)cc3 |
| Canonical SMILES | OpenEye OEToolkits | 1.7.6 | c1cc(ccc1C[C@H](CC(=O)N2C[C@H]([C@@H](C2)c3ccc(cc3)Cl)CO)N)Cl |
| InChI | InChI | 1.03 | InChI=1S/C21H24Cl2N2O2/c22-17-5-1-14(2-6-17)9-19(24)10-21(27)25-11-16(13-26)20(12-25)15-3-7-18(23)8-4-15/h1-8,16,19-20,26H,9-13,24H2/t16-,19+,20-/m0/s1 |
| InChIKey | InChI | 1.03 | ZFSKJGRASNTEBX-DBVUQKKJSA-N |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 118717749 |
| ChEMBL | CHEMBL3344388 |














