JAL
4-chloranyl-2-[(5-chloranyl-2-oxidanyl-phenyl)methyl]phenol
| Created: | 2021-05-07 |
| Last modified: | 2021-11-24 |
Find Related PDB Entry |
|---|
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 27 |
| Chiral Atom Count | 0 |
| Bond Count | 28 |
| Aromatic Bond Count | 12 |
Chemical Component Summary | |
|---|---|
| Name | 4-chloranyl-2-[(5-chloranyl-2-oxidanyl-phenyl)methyl]phenol |
| Synonyms | Dichlorophen |
| Systematic Name (OpenEye OEToolkits) | 4-chloranyl-2-[(5-chloranyl-2-oxidanyl-phenyl)methyl]phenol |
| Formula | C13 H10 Cl2 O2 |
| Molecular Weight | 269.123 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | CACTVS | 3.385 | Oc1ccc(Cl)cc1Cc2cc(Cl)ccc2O |
| SMILES | OpenEye OEToolkits | 2.0.7 | c1cc(c(cc1Cl)Cc2cc(ccc2O)Cl)O |
| Canonical SMILES | CACTVS | 3.385 | Oc1ccc(Cl)cc1Cc2cc(Cl)ccc2O |
| Canonical SMILES | OpenEye OEToolkits | 2.0.7 | c1cc(c(cc1Cl)Cc2cc(ccc2O)Cl)O |
| InChI | InChI | 1.03 | InChI=1S/C13H10Cl2O2/c14-10-1-3-12(16)8(6-10)5-9-7-11(15)2-4-13(9)17/h1-4,6-7,16-17H,5H2 |
| InChIKey | InChI | 1.03 | MDNWOSOZYLHTCG-UHFFFAOYSA-N |
Drug Info: DrugBank
DrugBank data are sourced from datasets licensed under a Creative Common's Attribution-NonCommercial 4.0 International License
| DrugBank ID | DB11396 |
|---|---|
| Name | Dichlorophen |
| Groups |
|
| Description | Dichlorophen is an antimicrobial agent shown to exert activity against cestodes, protozoa, fungi, and bacteria. It is often combined with toluene to remove parasites including ascarids, tapeworm, and hookworm from dogs and cats. |
| Synonyms |
|
| Categories |
|
| ATC-Code | P02DX02 |
| CAS number | 97-23-4 |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 3037 |
| ChEMBL | CHEMBL33845 |
| ChEBI | CHEBI:34689 |
| CCDC/CSD | ZZZJKK01 |














