LVO
5-acetamido-2,6-anhydro-4-carbamimidamido-3,4,5-trideoxy-7-O-methyl-9-O-octanoyl-D-glycero-D-galacto-non-2-enonic acid
| Created: | 2011-09-07 |
| Last modified: | 2020-07-17 |
Find Related PDB Entry |
|---|
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 69 |
| Chiral Atom Count | 5 |
| Bond Count | 69 |
| Aromatic Bond Count | 0 |
Chemical Component Summary | |
|---|---|
| Name | 5-acetamido-2,6-anhydro-4-carbamimidamido-3,4,5-trideoxy-7-O-methyl-9-O-octanoyl-D-glycero-D-galacto-non-2-enonic acid |
| Synonyms | 5-(acetylamino)-2,6-anhydro-4-carbamimidamido-3,4,5-trideoxy-7-O-methyl-9-O-octanoyl-D-glycero-D-galacto-non-2-enonic acid; Laninamivir octanoate |
| Systematic Name (OpenEye OEToolkits) | (2R,3R,4S)-3-acetamido-4-carbamimidamido-2-[(1R,2R)-1-methoxy-3-octanoyloxy-2-oxidanyl-propyl]-3,4-dihydro-2H-pyran-6-c arboxylic acid |
| Formula | C21 H36 N4 O8 |
| Molecular Weight | 472.533 |
| Type | D-SACCHARIDE |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | ACDLabs | 12.01 | O=C(OCC(O)C(OC)C1OC(=CC(NC(=[N@H])N)C1NC(=O)C)C(=O)O)CCCCCCC |
| SMILES | CACTVS | 3.370 | CCCCCCCC(=O)OC[CH](O)[CH](OC)[CH]1OC(=C[CH](NC(N)=N)[CH]1NC(C)=O)C(O)=O |
| SMILES | OpenEye OEToolkits | 1.7.2 | CCCCCCCC(=O)OCC(C(C1C(C(C=C(O1)C(=O)O)NC(=N)N)NC(=O)C)OC)O |
| Canonical SMILES | CACTVS | 3.370 | CCCCCCCC(=O)OC[C@@H](O)[C@@H](OC)[C@@H]1OC(=C[C@H](NC(N)=N)[C@H]1NC(C)=O)C(O)=O |
| Canonical SMILES | OpenEye OEToolkits | 1.7.2 | [H]/N=C(\N)/N[C@H]1C=C(O[C@H]([C@@H]1NC(=O)C)[C@@H]([C@@H](COC(=O)CCCCCCC)O)OC)C(=O)O |
| InChI | InChI | 1.03 | InChI=1S/C21H36N4O8/c1-4-5-6-7-8-9-16(28)32-11-14(27)18(31-3)19-17(24-12(2)26)13(25-21(22)23)10-15(33-19)20(29)30/h10,13-14,17-19,27H,4-9,11H2,1-3H3,(H,24,26)(H,29,30)(H4,22,23,25)/t13-,14+,17+,18+,19+/m0/s1 |
| InChIKey | InChI | 1.03 | UKTIJASCFRNWCB-RMIBSVFLSA-N |
Drug Info: DrugBank
DrugBank data are sourced from datasets licensed under a Creative Common's Attribution-NonCommercial 4.0 International License
| DrugBank ID | DB11888 |
|---|---|
| Name | Laninamivir octanoate |
| Groups | investigational |
| Description | Laninamivir octanoate has been used in trials studying the treatment of Asthma. |
| Synonyms | Laninamivir octanoate |
| Categories |
|
| CAS number | 203120-46-1 |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 9847629 |
| ChEMBL | CHEMBL467058 |
| ChEBI | CHEBI:134741 |














