7J0/PRD_002254
(2~{S})-~{N}-[(2~{S})-3-methoxy-1-(naphthalen-1-ylmethylamino)-1-oxidanylidene-propan-2-yl]-4-oxidanylidene-2-(3-phenylpropanoylamino)-4-piperidin-1-yl-butanamide
| Created: | 2016-10-31 |
| Last modified: | 2017-01-11 |
7J0/PRD_002254 is described in the Biologically Interesting Molecule Reference Dictionary (BIRD).
The representative PDB ID is 5TRY.
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 82 |
| Chiral Atom Count | 2 |
| Bond Count | 85 |
| Aromatic Bond Count | 17 |
Chemical Component Summary | |
|---|---|
| Name | (2~{S})-~{N}-[(2~{S})-3-methoxy-1-(naphthalen-1-ylmethylamino)-1-oxidanylidene-propan-2-yl]-4-oxidanylidene-2-(3-phenylpropanoylamino)-4-piperidin-1-yl-butanamide |
| Systematic Name (OpenEye OEToolkits) | (2~{S})-~{N}-[(2~{S})-3-methoxy-1-(naphthalen-1-ylmethylamino)-1-oxidanylidene-propan-2-yl]-4-oxidanylidene-2-(3-phenylpropanoylamino)-4-piperidin-1-yl-butanamide |
| Formula | C33 H40 N4 O5 |
| Molecular Weight | 572.694 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | ACDLabs | 12.01 | C(=O)(CCc1ccccc1)NC(CC(=O)N2CCCCC2)C(=O)NC(COC)C(=O)NCc3c4c(ccc3)cccc4 |
| SMILES | CACTVS | 3.385 | COC[CH](NC(=O)[CH](CC(=O)N1CCCCC1)NC(=O)CCc2ccccc2)C(=O)NCc3cccc4ccccc34 |
| SMILES | OpenEye OEToolkits | 2.0.6 | COCC(C(=O)NCc1cccc2c1cccc2)NC(=O)C(CC(=O)N3CCCCC3)NC(=O)CCc4ccccc4 |
| Canonical SMILES | CACTVS | 3.385 | COC[C@H](NC(=O)[C@H](CC(=O)N1CCCCC1)NC(=O)CCc2ccccc2)C(=O)NCc3cccc4ccccc34 |
| Canonical SMILES | OpenEye OEToolkits | 2.0.6 | COC[C@@H](C(=O)NCc1cccc2c1cccc2)NC(=O)[C@H](CC(=O)N3CCCCC3)NC(=O)CCc4ccccc4 |
| InChI | InChI | 1.03 | InChI=1S/C33H40N4O5/c1-42-23-29(32(40)34-22-26-15-10-14-25-13-6-7-16-27(25)26)36-33(41)28(21-31(39)37-19-8-3-9-20-37)35-30(38)18-17-24-11-4-2-5-12-24/h2,4-7,10-16,28-29H,3,8-9,17-23H2,1H3,(H,34,40)(H,35,38)(H,36,41)/t28-,29-/m0/s1 |
| InChIKey | InChI | 1.03 | WFBJQCJVXAHYAP-VMPREFPWSA-N |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 123132927 |














