SQL
(6E,10E,14E,18E)-2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaene
| Created: | 2012-06-07 |
| Last modified: | 2021-03-01 |
Find Related PDB Entry |
|---|
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 80 |
| Chiral Atom Count | 0 |
| Bond Count | 79 |
| Aromatic Bond Count | 0 |
Chemical Component Summary | |
|---|---|
| Name | (6E,10E,14E,18E)-2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaene |
| Synonyms | squalene |
| Systematic Name (OpenEye OEToolkits) | (6E,10E,14E,18E)-2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaene |
| Formula | C30 H50 |
| Molecular Weight | 410.718 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | ACDLabs | 12.01 | C(=C/CC/C(=C/CCC(=C/CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)C)/C)C)(\C)C |
| SMILES | CACTVS | 3.370 | CC(C)=CCCC(C)=CCCC(C)=CCCC=C(C)CCC=C(C)CCC=C(C)C |
| SMILES | OpenEye OEToolkits | 1.7.6 | CC(=CCCC(=CCCC(=CCCC=C(C)CCC=C(C)CCC=C(C)C)C)C)C |
| Canonical SMILES | CACTVS | 3.370 | CC(C)=CCC\C(C)=C\CC\C(C)=C\CC\C=C(/C)CC\C=C(C)\CCC=C(C)C |
| Canonical SMILES | OpenEye OEToolkits | 1.7.6 | CC(=CCC/C(=C/CC/C(=C/CC/C=C(/CC/C=C(/CCC=C(C)C)\C)\C)/C)/C)C |
| InChI | InChI | 1.03 | InChI=1S/C30H50/c1-25(2)15-11-19-29(7)23-13-21-27(5)17-9-10-18-28(6)22-14-24-30(8)20-12-16-26(3)4/h15-18,23-24H,9-14,19-22H2,1-8H3/b27-17+,28-18+,29-23+,30-24+ |
| InChIKey | InChI | 1.03 | YYGNTYWPHWGJRM-AAJYLUCBSA-N |
Drug Info: DrugBank
DrugBank data are sourced from datasets licensed under a Creative Common's Attribution-NonCommercial 4.0 International License
| DrugBank ID | DB11460 |
|---|---|
| Name | Squalene |
| Groups |
|
| Description | Squalene is originally obtained from shark liver oil. It is a natural 30-carbon isoprenoid compound and intermediate metabolite in the synthesis of cholesterol. It is not susceptible to lipid peroxidation and provides skin protection. It is ubiquitously distributed in human tissues where it is transported in serum generally in association with very low density lipoproteins. Squalene is investigated as an adjunctive cancer therapy. |
| Synonyms |
|
| Brand Names |
|
| Categories |
|
| CAS number | 111-02-4 |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 638072 |
| ChEMBL | CHEMBL458402 |
| ChEBI | CHEBI:15440 |














